C20H16FN5O5S — CID 68693816
2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl-methylcarbamic acid (PubChem CID 68693816) has the molecular formula C20H16FN5O5S and a molecular weight of 457.44 g/mol. Its IUPAC name is 2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl-methylcarbamic acid.
| Compound Name | 2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl-methylcarbamic acid |
|---|---|
| PubChem CID | 68693816 |
| Molecular Formula | C20H16FN5O5S |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl-methylcarbamic acid |
| SMILES | CN(CCn1cc(-c2cc3nccc(Oc4ccc([N+](=O)[O-])cc4F)c3s2)cn1)C(=O)O |
| InChI | InChI=1S/C20H16FN5O5S/c1-24(20(27)28)6-7-25-11-12(10-23-25)18-9-15-19(32-18)17(4-5-22-15)31-16-3-2-13(26(29)30)8-14(16)21/h2-5,8-11H,6-7H2,1H3,(H,27,28) |
| InChIKey | AGAOSBOOTQSFCF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|