C26H24ClFN2O4S — CID 123568430
2-[4-(chloromethyl)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine;hexan-2-one (PubChem CID 123568430) has the molecular formula C26H24ClFN2O4S and a molecular weight of 515.01 g/mol. Its IUPAC name is 2-[4-(chloromethyl)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine;hexan-2-one.
| Compound Name | 2-[4-(chloromethyl)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine;hexan-2-one |
|---|---|
| PubChem CID | 123568430 |
| Molecular Formula | C26H24ClFN2O4S |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 2-[4-(chloromethyl)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine;hexan-2-one |
| SMILES | CCCCC(C)=O.O=[N+]([O-])c1ccc(Oc2ccnc3cc(-c4ccc(CCl)cc4)sc23)c(F)c1 |
| InChI | InChI=1S/C20H12ClFN2O3S.C6H12O/c21-11-12-1-3-13(4-2-12)19-10-16-20(28-19)18(7-8-23-16)27-17-6-5-14(24(25)26)9-15(17)22;1-3-4-5-6(2)7/h1-10H,11H2;3-5H2,1-2H3 |
| InChIKey | TXXQSRWVQJJISP-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|