C26H28FN5O3S — CID 126590485
N'-[2-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl-methylamino]ethyl]-N-methylethane-1,2-diamine (PubChem CID 126590485) has the molecular formula C26H28FN5O3S and a molecular weight of 509.61 g/mol. Its IUPAC name is N'-[2-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl-methylamino]ethyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[2-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl-methylamino]ethyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 126590485 |
| Molecular Formula | C26H28FN5O3S |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N'-[2-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl-methylamino]ethyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCN(C)Cc1ccc(-c2cc3nccc(Oc4ccc([N+](=O)[O-])cc4F)c3s2)cc1 |
| InChI | InChI=1S/C26H28FN5O3S/c1-28-11-12-29-13-14-31(2)17-18-3-5-19(6-4-18)25-16-22-26(36-25)24(9-10-30-22)35-23-8-7-20(32(33)34)15-21(23)27/h3-10,15-16,28-29H,11-14,17H2,1-2H3 |
| InChIKey | MFVCPHVMOBIBLO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|