C22H19FN4O3S2 — CID 67443017
N-[[6-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-3-pyridinyl]methyl]-2-methylsulfanylethanamine (PubChem CID 67443017) has the molecular formula C22H19FN4O3S2 and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[[6-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-3-pyridinyl]methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[[6-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-3-pyridinyl]methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 67443017 |
| Molecular Formula | C22H19FN4O3S2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | N-[[6-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-3-pyridinyl]methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1ccc(-c2cc3nccc(Oc4ccc([N+](=O)[O-])cc4F)c3s2)nc1 |
| InChI | InChI=1S/C22H19FN4O3S2/c1-31-9-8-24-12-14-2-4-17(26-13-14)21-11-18-22(32-21)20(6-7-25-18)30-19-5-3-15(27(28)29)10-16(19)23/h2-7,10-11,13,24H,8-9,12H2,1H3 |
| InChIKey | YDBXZNUCFGTBQO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|