C28H28FN3O3S — CID 58207645
cyclobutyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate (PubChem CID 58207645) has the molecular formula C28H28FN3O3S and a molecular weight of 505.62 g/mol. Its IUPAC name is cyclobutyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate.
| Compound Name | cyclobutyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 58207645 |
| Molecular Formula | C28H28FN3O3S |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | cyclobutyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate |
| SMILES | CCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)OC5CCC5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C28H28FN3O3S/c1-2-11-30-16-19-6-8-22(32-17-19)26-15-23-28(36-26)25(10-12-31-23)35-24-9-7-18(13-21(24)29)14-27(33)34-20-4-3-5-20/h6-10,12-13,15,17,20,30H,2-5,11,14,16H2,1H3 |
| InChIKey | NXUKDFNUQQULSZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|