C29H30FN3O3S — CID 58207763
cyclopentyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate (PubChem CID 58207763) has the molecular formula C29H30FN3O3S and a molecular weight of 519.64 g/mol. Its IUPAC name is cyclopentyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate.
| Compound Name | cyclopentyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 58207763 |
| Molecular Formula | C29H30FN3O3S |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | cyclopentyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate |
| SMILES | CCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)OC5CCCC5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C29H30FN3O3S/c1-2-12-31-17-20-7-9-23(33-18-20)27-16-24-29(37-27)26(11-13-32-24)36-25-10-8-19(14-22(25)30)15-28(34)35-21-5-3-4-6-21/h7-11,13-14,16,18,21,31H,2-6,12,15,17H2,1H3 |
| InChIKey | ZPWGWMIPPJPIKY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|