C30H32FN4O2S — CID 58207698
CID 58207698 (PubChem CID 58207698) has the molecular formula C30H32FN4O2S and a molecular weight of 531.68 g/mol.
| Compound Name | CID 58207698 |
|---|---|
| PubChem CID | 58207698 |
| Molecular Formula | C30H32FN4O2S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | — |
| SMILES | N[CH]CCCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)CC5CC5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C30H32FN4O2S/c31-24-16-21(15-23(36)14-20-4-5-20)7-9-27(24)37-28-10-13-34-26-17-29(38-30(26)28)25-8-6-22(19-35-25)18-33-12-3-1-2-11-32/h6-11,13,16-17,19-20,33H,1-5,12,14-15,18,32H2 |
| InChIKey | PJMGAFOBHFWLDQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|