C13H6BrFN2O3S — CID 59424521
2-bromo-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine (PubChem CID 59424521) has the molecular formula C13H6BrFN2O3S and a molecular weight of 369.17 g/mol. Its IUPAC name is 2-bromo-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine.
| Compound Name | 2-bromo-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 59424521 |
| Molecular Formula | C13H6BrFN2O3S |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | 2-bromo-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccnc3cc(Br)sc23)c(F)c1 |
| InChI | InChI=1S/C13H6BrFN2O3S/c14-12-6-9-13(21-12)11(3-4-16-9)20-10-2-1-7(17(18)19)5-8(10)15/h1-6H |
| InChIKey | ZTUKRGQWDZCKQG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|