C14H7FN2O5S — CID 59424536
7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine-2-carboxylic acid (PubChem CID 59424536) has the molecular formula C14H7FN2O5S and a molecular weight of 334.28 g/mol. Its IUPAC name is 7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine-2-carboxylic acid.
| Compound Name | 7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59424536 |
| Molecular Formula | C14H7FN2O5S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2nccc(Oc3ccc([N+](=O)[O-])cc3F)c2s1 |
| InChI | InChI=1S/C14H7FN2O5S/c15-8-5-7(17(20)21)1-2-10(8)22-11-3-4-16-9-6-12(14(18)19)23-13(9)11/h1-6H,(H,18,19) |
| InChIKey | YJWLZQUFCCNKKY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|