C22H18FN3O5S — CID 89202522
(1Z,3E)-4-(1,3-dioxolan-2-yl)-1-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]hexa-1,3,5-trien-1-amine (PubChem CID 89202522) has the molecular formula C22H18FN3O5S and a molecular weight of 455.47 g/mol. Its IUPAC name is (1Z,3E)-4-(1,3-dioxolan-2-yl)-1-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-4-(1,3-dioxolan-2-yl)-1-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89202522 |
| Molecular Formula | C22H18FN3O5S |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (1Z,3E)-4-(1,3-dioxolan-2-yl)-1-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(=C\C=C(/N)c1cc2nccc(Oc3ccc([N+](=O)[O-])cc3F)c2s1)C1OCCO1 |
| InChI | InChI=1S/C22H18FN3O5S/c1-2-13(22-29-9-10-30-22)3-5-16(24)20-12-17-21(32-20)19(7-8-25-17)31-18-6-4-14(26(27)28)11-15(18)23/h2-8,11-12,22H,1,9-10,24H2/b13-3+,16-5- |
| InChIKey | WPAHBAXZVXCEGZ-REZTUCJMSA-N |
| XLogP | 4.92 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|