C17H11FN2O6 — CID 155384922
10-(2-fluoro-4-nitrophenoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-ol (PubChem CID 155384922) has the molecular formula C17H11FN2O6 and a molecular weight of 358.28 g/mol. Its IUPAC name is 10-(2-fluoro-4-nitrophenoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-ol.
| Compound Name | 10-(2-fluoro-4-nitrophenoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-ol |
|---|---|
| PubChem CID | 155384922 |
| Molecular Formula | C17H11FN2O6 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 10-(2-fluoro-4-nitrophenoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-ol |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccnc3cc(O)c4c(c23)OCCO4)c(F)c1 |
| InChI | InChI=1S/C17H11FN2O6/c18-10-7-9(20(22)23)1-2-13(10)26-14-3-4-19-11-8-12(21)16-17(15(11)14)25-6-5-24-16/h1-4,7-8,21H,5-6H2 |
| InChIKey | IGYKAWAHUBRJHO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|