C14H7ClFN3O3 — CID 156871736
6-chloro-4-(2-fluoro-4-nitrophenoxy)-1,7-naphthyridine (PubChem CID 156871736) has the molecular formula C14H7ClFN3O3 and a molecular weight of 319.68 g/mol. Its IUPAC name is 6-chloro-4-(2-fluoro-4-nitrophenoxy)-1,7-naphthyridine.
| Compound Name | 6-chloro-4-(2-fluoro-4-nitrophenoxy)-1,7-naphthyridine |
|---|---|
| PubChem CID | 156871736 |
| Molecular Formula | C14H7ClFN3O3 |
| Molecular Weight | 319.68 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 6-chloro-4-(2-fluoro-4-nitrophenoxy)-1,7-naphthyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccnc3cnc(Cl)cc23)c(F)c1 |
| InChI | InChI=1S/C14H7ClFN3O3/c15-14-6-9-11(7-18-14)17-4-3-12(9)22-13-2-1-8(19(20)21)5-10(13)16/h1-7H |
| InChIKey | WYQWIDQBAGHOBB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|