C12H7Cl2FN2O3 — CID 116519429
2,4-dichloro-5-[(2-fluoro-4-nitrophenoxy)methyl]pyridine (PubChem CID 116519429) has the molecular formula C12H7Cl2FN2O3 and a molecular weight of 317.10 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-fluoro-4-nitrophenoxy)methyl]pyridine.
| Compound Name | 2,4-dichloro-5-[(2-fluoro-4-nitrophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 116519429 |
| Molecular Formula | C12H7Cl2FN2O3 |
| Molecular Weight | 317.10 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 2,4-dichloro-5-[(2-fluoro-4-nitrophenoxy)methyl]pyridine |
| SMILES | O=[N+]([O-])c1ccc(OCc2cnc(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C12H7Cl2FN2O3/c13-9-4-12(14)16-5-7(9)6-20-11-2-1-8(17(18)19)3-10(11)15/h1-5H,6H2 |
| InChIKey | ZMZCLFIBLUYEFR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.10 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|