C14H9ClFNO5 — CID 52618950
4-chloro-6-[(2-fluoro-4-nitrophenoxy)methyl]-1,3-benzodioxole (PubChem CID 52618950) has the molecular formula C14H9ClFNO5 and a molecular weight of 325.68 g/mol. Its IUPAC name is 4-chloro-6-[(2-fluoro-4-nitrophenoxy)methyl]-1,3-benzodioxole.
| Compound Name | 4-chloro-6-[(2-fluoro-4-nitrophenoxy)methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 52618950 |
| Molecular Formula | C14H9ClFNO5 |
| Molecular Weight | 325.68 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 4-chloro-6-[(2-fluoro-4-nitrophenoxy)methyl]-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1ccc(OCc2cc(Cl)c3c(c2)OCO3)c(F)c1 |
| InChI | InChI=1S/C14H9ClFNO5/c15-10-3-8(4-13-14(10)22-7-21-13)6-20-12-2-1-9(17(18)19)5-11(12)16/h1-5H,6-7H2 |
| InChIKey | BICATJDPTLECCO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.68 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|