C16H10ClN3O5 — CID 17410942
3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-6-nitroquinazolin-4-one (PubChem CID 17410942) has the molecular formula C16H10ClN3O5 and a molecular weight of 359.73 g/mol. Its IUPAC name is 3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-6-nitroquinazolin-4-one.
| Compound Name | 3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-6-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 17410942 |
| Molecular Formula | C16H10ClN3O5 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-6-nitroquinazolin-4-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2ncn1Cc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C16H10ClN3O5/c17-12-3-9(4-14-15(12)25-8-24-14)6-19-7-18-13-2-1-10(20(22)23)5-11(13)16(19)21/h1-5,7H,6,8H2 |
| InChIKey | LSPCRLYTMWCYIQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|