C16H10Cl2N4O4 — CID 84601847
N-(3,4-dichlorophenyl)-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 84601847) has the molecular formula C16H10Cl2N4O4 and a molecular weight of 393.19 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 84601847 |
| Molecular Formula | C16H10Cl2N4O4 |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccc([N+](=O)[O-])cc2c1=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl2N4O4/c17-12-3-1-9(5-13(12)18)20-15(23)7-21-8-19-14-4-2-10(22(25)26)6-11(14)16(21)24/h1-6,8H,7H2,(H,20,23) |
| InChIKey | OOQBUAFSBHNLLB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|