C19H16N4O6 — CID 4850916
ethyl 4-[[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]amino]benzoate (PubChem CID 4850916) has the molecular formula C19H16N4O6 and a molecular weight of 396.36 g/mol. Its IUPAC name is ethyl 4-[[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4850916 |
| Molecular Formula | C19H16N4O6 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | ethyl 4-[[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2cnc3ccc([N+](=O)[O-])cc3c2=O)cc1 |
| InChI | InChI=1S/C19H16N4O6/c1-2-29-19(26)12-3-5-13(6-4-12)21-17(24)10-22-11-20-16-8-7-14(23(27)28)9-15(16)18(22)25/h3-9,11H,2,10H2,1H3,(H,21,24) |
| InChIKey | WIKFIECSSFTWCZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|