C18H16N4O6S — CID 55465085
ethyl 3-methyl-5-[[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]amino]thiophene-2-carboxylate (PubChem CID 55465085) has the molecular formula C18H16N4O6S and a molecular weight of 416.42 g/mol. Its IUPAC name is ethyl 3-methyl-5-[[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55465085 |
| Molecular Formula | C18H16N4O6S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | ethyl 3-methyl-5-[[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)cc1C |
| InChI | InChI=1S/C18H16N4O6S/c1-3-28-18(25)16-10(2)6-15(29-16)20-14(23)8-21-9-19-13-7-11(22(26)27)4-5-12(13)17(21)24/h4-7,9H,3,8H2,1-2H3,(H,20,23) |
| InChIKey | QNBWXMQJSMMLGL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|