C17H13N5O7 — CID 4034361
N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 4034361) has the molecular formula C17H13N5O7 and a molecular weight of 399.32 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 4034361 |
| Molecular Formula | C17H13N5O7 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)Cn1cnc2cc([N+](=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C17H13N5O7/c1-29-15-5-3-11(22(27)28)7-14(15)19-16(23)8-20-9-18-13-6-10(21(25)26)2-4-12(13)17(20)24/h2-7,9H,8H2,1H3,(H,19,23) |
| InChIKey | DGDHASCTLQIARH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 159.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|