C21H17N5O6S — CID 55357113
N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55357113) has the molecular formula C21H17N5O6S and a molecular weight of 467.46 g/mol. Its IUPAC name is N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55357113 |
| Molecular Formula | C21H17N5O6S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)Cn3cnc4cc([N+](=O)[O-])ccc4c3=O)n2)c(OC)c1 |
| InChI | InChI=1S/C21H17N5O6S/c1-31-13-4-6-14(18(8-13)32-2)17-10-33-21(23-17)24-19(27)9-25-11-22-16-7-12(26(29)30)3-5-15(16)20(25)28/h3-8,10-11H,9H2,1-2H3,(H,23,24,27) |
| InChIKey | QZQYDQZLAXPPBL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|