C18H16N4O4 — CID 84602357
N-(2,6-dimethylphenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 84602357) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 84602357 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)Cn1cnc2cc([N+](=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C18H16N4O4/c1-11-4-3-5-12(2)17(11)20-16(23)9-21-10-19-15-8-13(22(25)26)6-7-14(15)18(21)24/h3-8,10H,9H2,1-2H3,(H,20,23) |
| InChIKey | WGTURZHMOCLFPO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|