C16H13N5O6S — CID 55308255
2-(7-nitro-4-oxoquinazolin-3-yl)-N-(3-sulfamoylphenyl)acetamide (PubChem CID 55308255) has the molecular formula C16H13N5O6S and a molecular weight of 403.38 g/mol. Its IUPAC name is 2-(7-nitro-4-oxoquinazolin-3-yl)-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(7-nitro-4-oxoquinazolin-3-yl)-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 55308255 |
| Molecular Formula | C16H13N5O6S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 2-(7-nitro-4-oxoquinazolin-3-yl)-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)c1 |
| InChI | InChI=1S/C16H13N5O6S/c17-28(26,27)12-3-1-2-10(6-12)19-15(22)8-20-9-18-14-7-11(21(24)25)4-5-13(14)16(20)23/h1-7,9H,8H2,(H,19,22)(H2,17,26,27) |
| InChIKey | NVDBJIXFGFHEHO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 167.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|