C17H11N5O4 — CID 84602361
N-(3-cyanophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 84602361) has the molecular formula C17H11N5O4 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 84602361 |
| Molecular Formula | C17H11N5O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-(3-cyanophenyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)c1 |
| InChI | InChI=1S/C17H11N5O4/c18-8-11-2-1-3-12(6-11)20-16(23)9-21-10-19-15-7-13(22(25)26)4-5-14(15)17(21)24/h1-7,10H,9H2,(H,20,23) |
| InChIKey | LOMQNFBNEPDHTP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|