C19H13N5O6 — CID 55379185
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55379185) has the molecular formula C19H13N5O6 and a molecular weight of 407.34 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55379185 |
| Molecular Formula | C19H13N5O6 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)Cn3cnc4cc([N+](=O)[O-])ccc4c3=O)cc2C1=O |
| InChI | InChI=1S/C19H13N5O6/c1-22-17(26)12-4-2-10(6-14(12)18(22)27)21-16(25)8-23-9-20-15-7-11(24(29)30)3-5-13(15)19(23)28/h2-7,9H,8H2,1H3,(H,21,25) |
| InChIKey | BLYQOVJTTWFZBM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|