C19H17N5O5 — CID 55308269
N-[(2,4-dimethylphenyl)carbamoyl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55308269) has the molecular formula C19H17N5O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamoyl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55308269 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C19H17N5O5/c1-11-3-6-15(12(2)7-11)21-19(27)22-17(25)9-23-10-20-16-8-13(24(28)29)4-5-14(16)18(23)26/h3-8,10H,9H2,1-2H3,(H2,21,22,25,27) |
| InChIKey | LKQOPOQWFFPLKI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|