C16H17N5O5 — CID 4636840
N-(cyclopentylcarbamoyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 4636840) has the molecular formula C16H17N5O5 and a molecular weight of 359.34 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 4636840 |
| Molecular Formula | C16H17N5O5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2cc([N+](=O)[O-])ccc2c1=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H17N5O5/c22-14(19-16(24)18-10-3-1-2-4-10)8-20-9-17-13-7-11(21(25)26)5-6-12(13)15(20)23/h5-7,9-10H,1-4,8H2,(H2,18,19,22,24) |
| InChIKey | JNCPWBGBPCKMRL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|