C14H14N4O6S — CID 6600513
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 6600513) has the molecular formula C14H14N4O6S and a molecular weight of 366.36 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 6600513 |
| Molecular Formula | C14H14N4O6S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2cc([N+](=O)[O-])ccc2c1=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14N4O6S/c19-13(16-9-3-4-25(23,24)7-9)6-17-8-15-12-5-10(18(21)22)1-2-11(12)14(17)20/h1-2,5,8-9H,3-4,6-7H2,(H,16,19)/t9-/m0/s1 |
| InChIKey | YNTXUTPQCVHPRS-VIFPVBQESA-N |
| XLogP | -0.39 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|