C19H22N4O6S — CID 55390306
N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55390306) has the molecular formula C19H22N4O6S and a molecular weight of 434.47 g/mol. Its IUPAC name is N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55390306 |
| Molecular Formula | C19H22N4O6S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2cc([N+](=O)[O-])ccc2c1=O)N(C1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H22N4O6S/c24-18(22(13-3-1-2-4-13)15-7-8-30(28,29)11-15)10-21-12-20-17-9-14(23(26)27)5-6-16(17)19(21)25/h5-6,9,12-13,15H,1-4,7-8,10-11H2 |
| InChIKey | RUJZTTOUYUQUNR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 132.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|