C18H23ClN2O6S — CID 2569224
2-(2-chloro-4-nitrophenoxy)-N-cyclohexyl-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 2569224) has the molecular formula C18H23ClN2O6S and a molecular weight of 430.91 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-N-cyclohexyl-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-N-cyclohexyl-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 2569224 |
| Molecular Formula | C18H23ClN2O6S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-N-cyclohexyl-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cl)N(C1CCCCC1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H23ClN2O6S/c19-16-10-14(21(23)24)6-7-17(16)27-11-18(22)20(13-4-2-1-3-5-13)15-8-9-28(25,26)12-15/h6-7,10,13,15H,1-5,8-9,11-12H2/t15-/m1/s1 |
| InChIKey | ZMAFQARWKUWPGJ-OAHLLOKOSA-N |
| XLogP | 2.98 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|