C15H19ClN2O6S — CID 7865974
2-(2-chloro-4-nitrophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylacetamide (PubChem CID 7865974) has the molecular formula C15H19ClN2O6S and a molecular weight of 390.85 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylacetamide.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 7865974 |
| Molecular Formula | C15H19ClN2O6S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylacetamide |
| SMILES | CCCN(C(=O)COc1ccc([N+](=O)[O-])cc1Cl)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19ClN2O6S/c1-2-6-17(12-5-7-25(22,23)10-12)15(19)9-24-14-4-3-11(18(20)21)8-13(14)16/h3-4,8,12H,2,5-7,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | OAMLUPANFYDEGO-GFCCVEGCSA-N |
| XLogP | 2.05 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|