C19H19ClN2O6S — CID 41032339
N-[(4-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-nitrophenoxy)acetamide (PubChem CID 41032339) has the molecular formula C19H19ClN2O6S and a molecular weight of 438.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 41032339 |
| Molecular Formula | C19H19ClN2O6S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)N(Cc1ccc(Cl)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19ClN2O6S/c20-15-3-1-14(2-4-15)11-21(17-9-10-29(26,27)13-17)19(23)12-28-18-7-5-16(6-8-18)22(24)25/h1-8,17H,9-13H2/t17-/m0/s1 |
| InChIKey | FZBYWHNXSWVCDM-KRWDZBQOSA-N |
| XLogP | 2.84 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|