C19H19FN2O6S — CID 27316931
N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-fluorophenyl)methyl]-2-(4-nitrophenoxy)acetamide (PubChem CID 27316931) has the molecular formula C19H19FN2O6S and a molecular weight of 422.43 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-fluorophenyl)methyl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-fluorophenyl)methyl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 27316931 |
| Molecular Formula | C19H19FN2O6S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-fluorophenyl)methyl]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)N(Cc1ccccc1F)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19FN2O6S/c20-18-4-2-1-3-14(18)11-21(16-9-10-29(26,27)13-16)19(23)12-28-17-7-5-15(6-8-17)22(24)25/h1-8,16H,9-13H2/t16-/m1/s1 |
| InChIKey | SLWOFWJMWJSQFM-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|