C18H16ClFN2O4 — CID 8587517
2-(2-chloro-4-nitrophenoxy)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 8587517) has the molecular formula C18H16ClFN2O4 and a molecular weight of 378.79 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8587517 |
| Molecular Formula | C18H16ClFN2O4 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cl)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C18H16ClFN2O4/c19-15-9-14(22(24)25)7-8-17(15)26-11-18(23)21(13-5-6-13)10-12-3-1-2-4-16(12)20/h1-4,7-9,13H,5-6,10-11H2 |
| InChIKey | XVTKVIVVARBPPH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|