C18H18FN3O5 — CID 18103051
[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate (PubChem CID 18103051) has the molecular formula C18H18FN3O5 and a molecular weight of 375.36 g/mol. Its IUPAC name is [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate.
| Compound Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18103051 |
| Molecular Formula | C18H18FN3O5 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)OCC(=O)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C18H18FN3O5/c1-20-10-14(22(25)26)8-16(20)18(24)27-11-17(23)21(13-6-7-13)9-12-4-2-3-5-15(12)19/h2-5,8,10,13H,6-7,9,11H2,1H3 |
| InChIKey | NGSXEHCIUZBLFQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|