C20H20FNO4S — CID 11927485
[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate (PubChem CID 11927485) has the molecular formula C20H20FNO4S and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate.
| Compound Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927485 |
| Molecular Formula | C20H20FNO4S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate |
| SMILES | C[S@](=O)c1ccccc1C(=O)OCC(=O)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C20H20FNO4S/c1-27(25)18-9-5-3-7-16(18)20(24)26-13-19(23)22(15-10-11-15)12-14-6-2-4-8-17(14)21/h2-9,15H,10-13H2,1H3/t27-/m0/s1 |
| InChIKey | LKHSRFAYEKTQLX-MHZLTWQESA-N |
| XLogP | 2.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |