C20H20FNO5 — CID 9406115
[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-4-methoxybenzoate (PubChem CID 9406115) has the molecular formula C20H20FNO5 and a molecular weight of 373.38 g/mol. Its IUPAC name is [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-4-methoxybenzoate.
| Compound Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 9406115 |
| Molecular Formula | C20H20FNO5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N(Cc2ccccc2F)C2CC2)c(O)c1 |
| InChI | InChI=1S/C20H20FNO5/c1-26-15-8-9-16(18(23)10-15)20(25)27-12-19(24)22(14-6-7-14)11-13-4-2-3-5-17(13)21/h2-5,8-10,14,23H,6-7,11-12H2,1H3 |
| InChIKey | NAJZMQXQRXXVNU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |