C22H22FNO4 — CID 9288941
[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate (PubChem CID 9288941) has the molecular formula C22H22FNO4 and a molecular weight of 383.42 g/mol. Its IUPAC name is [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9288941 |
| Molecular Formula | C22H22FNO4 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccccc1/C=C/C(=O)OCC(=O)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C22H22FNO4/c1-27-20-9-5-3-6-16(20)10-13-22(26)28-15-21(25)24(18-11-12-18)14-17-7-2-4-8-19(17)23/h2-10,13,18H,11-12,14-15H2,1H3/b13-10+ |
| InChIKey | OTMJIZOJUVAQHF-JLHYYAGUSA-N |
| XLogP | 3.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|