C12H13NO4 — CID 2541550
(2-amino-2-oxoethyl) (E)-3-(2-methoxyphenyl)prop-2-enoate (PubChem CID 2541550) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (E)-3-(2-methoxyphenyl)prop-2-enoate.
| Compound Name | (2-amino-2-oxoethyl) (E)-3-(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2541550 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (2-amino-2-oxoethyl) (E)-3-(2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccccc1/C=C/C(=O)OCC(N)=O |
| InChI | InChI=1S/C12H13NO4/c1-16-10-5-3-2-4-9(10)6-7-12(15)17-8-11(13)14/h2-7H,8H2,1H3,(H2,13,14)/b7-6+ |
| InChIKey | SEWOXDAXPNMLSS-VOTSOKGWSA-N |
| XLogP | 0.74 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|