C19H25NO6 — CID 9289081
methyl (2S,3S)-2-[[2-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-3-methylpentanoate (PubChem CID 9289081) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl (2S,3S)-2-[[2-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[[2-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 9289081 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | methyl (2S,3S)-2-[[2-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)COC(=O)/C=C/c1ccccc1OC)C(=O)OC |
| InChI | InChI=1S/C19H25NO6/c1-5-13(2)18(19(23)25-4)20-16(21)12-26-17(22)11-10-14-8-6-7-9-15(14)24-3/h6-11,13,18H,5,12H2,1-4H3,(H,20,21)/b11-10+/t13-,18-/m0/s1 |
| InChIKey | JSJRDBIHQCSPBH-HWLHTRRRSA-N |
| XLogP | 1.96 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|