C19H25NO5 — CID 8568678
methyl (2S,3R)-3-methyl-2-[[2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyacetyl]amino]pentanoate (PubChem CID 8568678) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl (2S,3R)-3-methyl-2-[[2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyacetyl]amino]pentanoate.
| Compound Name | methyl (2S,3R)-3-methyl-2-[[2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyacetyl]amino]pentanoate |
|---|---|
| PubChem CID | 8568678 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | methyl (2S,3R)-3-methyl-2-[[2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyacetyl]amino]pentanoate |
| SMILES | CC[C@@H](C)C(NC(=O)COC(=O)/C=C/c1cccc(C)c1)C(=O)OC |
| InChI | InChI=1S/C19H25NO5/c1-5-14(3)18(19(23)24-4)20-16(21)12-25-17(22)10-9-15-8-6-7-13(2)11-15/h6-11,14,18H,5,12H2,1-4H3,(H,20,21)/b10-9+/t14-,18?/m1/s1 |
| InChIKey | FRDGIKNFQVQTTO-PFMLPDLDSA-N |
| XLogP | 2.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|