C21H21NO5 — CID 7883356
[2-[[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate (PubChem CID 7883356) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is [2-[[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate.
| Compound Name | [2-[[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7883356 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [2-[[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
| SMILES | Cc1cccc(/C=C/C(=O)OCC(=O)N[C@@H](C)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C21H21NO5/c1-14-4-3-5-16(10-14)6-9-21(24)25-12-20(23)22-15(2)17-7-8-18-19(11-17)27-13-26-18/h3-11,15H,12-13H2,1-2H3,(H,22,23)/b9-6+/t15-/m0/s1 |
| InChIKey | JZCVJHGMECIAMI-PPYMECGQSA-N |
| XLogP | 3.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|