C17H23NO3 — CID 7882683
[2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate (PubChem CID 7882683) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7882683 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
| SMILES | CCC(CC)NC(=O)COC(=O)/C=C/c1cccc(C)c1 |
| InChI | InChI=1S/C17H23NO3/c1-4-15(5-2)18-16(19)12-21-17(20)10-9-14-8-6-7-13(3)11-14/h6-11,15H,4-5,12H2,1-3H3,(H,18,19)/b10-9+ |
| InChIKey | QFIIABHEEQRWQL-MDZDMXLPSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|