C12H15NO4 — CID 35079410
N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-2-methoxyacetamide (PubChem CID 35079410) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-2-methoxyacetamide.
| Compound Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 35079410 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@@H](C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H15NO4/c1-8(13-12(14)6-15-2)9-3-4-10-11(5-9)17-7-16-10/h3-5,8H,6-7H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | ZDTAUCABGGVFOF-QMMMGPOBSA-N |
| XLogP | 1.24 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |