C19H19NO5 — CID 7763941
2-(4-acetylphenoxy)-N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide (PubChem CID 7763941) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 7763941 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide |
| SMILES | CC(=O)c1ccc(OCC(=O)N[C@@H](C)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-12(15-5-8-17-18(9-15)25-11-24-17)20-19(22)10-23-16-6-3-14(4-7-16)13(2)21/h3-9,12H,10-11H2,1-2H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | XUYFOSCZGOTORX-LBPRGKRZSA-N |
| XLogP | 2.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |