C11H12ClNO3 — CID 3554698
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-chloroacetamide (PubChem CID 3554698) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-chloroacetamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 3554698 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-chloroacetamide |
| SMILES | CC(NC(=O)CCl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12ClNO3/c1-7(13-11(14)5-12)8-2-3-9-10(4-8)16-6-15-9/h2-4,7H,5-6H2,1H3,(H,13,14) |
| InChIKey | FWWRYKFYHFHDRT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|