C19H18ClNO4 — CID 35079496
N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(4-chlorophenyl)-4-oxobutanamide (PubChem CID 35079496) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(4-chlorophenyl)-4-oxobutanamide.
| Compound Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(4-chlorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 35079496 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(4-chlorophenyl)-4-oxobutanamide |
| SMILES | C[C@H](NC(=O)CCC(=O)c1ccc(Cl)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18ClNO4/c1-12(14-4-8-17-18(10-14)25-11-24-17)21-19(23)9-7-16(22)13-2-5-15(20)6-3-13/h2-6,8,10,12H,7,9,11H2,1H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | JJJNJTUTEKCZFO-LBPRGKRZSA-N |
| XLogP | 3.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |