C17H16ClNO3S — CID 16540605
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 16540605) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 16540605 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | CC(NC(=O)CSc1ccc(Cl)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16ClNO3S/c1-11(12-2-7-15-16(8-12)22-10-21-15)19-17(20)9-23-14-5-3-13(18)4-6-14/h2-8,11H,9-10H2,1H3,(H,19,20) |
| InChIKey | DPYQADRPMUFRQH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |