C14H20N2O3 — CID 43567784
2-[1-(1,3-benzodioxol-5-yl)ethylamino]-N-propan-2-ylacetamide (PubChem CID 43567784) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 43567784 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNC(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-9(2)16-14(17)7-15-10(3)11-4-5-12-13(6-11)19-8-18-12/h4-6,9-10,15H,7-8H2,1-3H3,(H,16,17) |
| InChIKey | KBYXERZRSCOYMW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |