C16H23N2O3+ — CID 8894563
N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-piperidin-1-ium-1-ylacetamide (PubChem CID 8894563) has the molecular formula C16H23N2O3+ and a molecular weight of 291.37 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 8894563 |
| Molecular Formula | C16H23N2O3+ |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-piperidin-1-ium-1-ylacetamide |
| SMILES | C[C@@H](NC(=O)C[NH+]1CCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H22N2O3/c1-12(13-5-6-14-15(9-13)21-11-20-14)17-16(19)10-18-7-3-2-4-8-18/h5-6,9,12H,2-4,7-8,10-11H2,1H3,(H,17,19)/p+1/t12-/m1/s1 |
| InChIKey | IGAAPTZUILEEJW-GFCCVEGCSA-O |
| XLogP | 0.66 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |