C17H27N2O+ — CID 8894626
N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-piperidin-1-ium-1-ylacetamide (PubChem CID 8894626) has the molecular formula C17H27N2O+ and a molecular weight of 275.42 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 8894626 |
| Molecular Formula | C17H27N2O+ |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-piperidin-1-ium-1-ylacetamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)C[NH+]2CCCCC2)cc1C |
| InChI | InChI=1S/C17H26N2O/c1-13-7-8-16(11-14(13)2)15(3)18-17(20)12-19-9-5-4-6-10-19/h7-8,11,15H,4-6,9-10,12H2,1-3H3,(H,18,20)/p+1/t15-/m0/s1 |
| InChIKey | WRLYWDDVLWTEIY-HNNXBMFYSA-O |
| XLogP | 1.55 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |